2024年4月29日 · benzil - cas 134-81-6, synthesis, structure, density, melting point, boiling point

Benzil | C14H10O2 | CID 8651 - structure, chemical names, physical and chemical properties, classification, patents, literature, biological activities, safety/hazards/toxicity information, supplier lists, and more.

Molar mass: 210.232 g·mol −1 Appearance yellow crystalline powder Density: 1.23 g/cm 3, solid (1.255 g/cm 3, x-ray) Melting point: 94.0 to 96.0 °C; 201.2 to 204.8 °F; 367.1 to 369.2 K Boiling point: 346.0 to 348.0 °C; 654.8 to 658.4 °F; 619.1 to 621.1 K

2010年2月6日 · The molecular weight of BENZIL is determined by the sum of the atomic weights of each constituent element multiplied by the number of atoms, which is calculated to be: $$ 210.228 · \frac{g}{mol} $$ The exact term of the above molecular weight is “molar mass”, which is based on the atomic mass of each element.

Calculate molar mass of each element: multiply the atomic mass of each element by the number of atoms of that element in the compound. Add them together: add the results from step 3 to get the total molar mass of the compound.

There are 4 easy steps to find the molar mass of C14O2H10 based on its chemical formula. 1. Count The Number of Each Atom. The first step to finding the molar mass of Benzil is to count the number of each atom present in a single molecule using the chemical formula, C14O2H10: 2. Find Atomic Mass of Each Element.

ChemSpider record containing structure, synonyms, properties, vendors and database links for Benzil, 134-81-6, 608047, WURBFLDFSFBTLW-UHFFFAOYSA-N

The molar mass of Benzil is approximately 210.2 g/mol and its density is around 1.23 g/cm³. In comparison to common food items, Benzil has a higher molar mass and density than most carbohydrates like sugar or flour.

Benzil molecular weight. Molar mass of (C6H5CO)2 = 210.228 g/mol. Convert grams Benzil to moles. or. moles Benzil to grams. Molecular weight calculation: (12.0107*6 + 1.00794*5 + 12.0107 + 15.9994)*2

Benzil UNII S85X61172J Molecular formula C 14 H 10 O 2 Molecular weight 210.23 Percent composition C 79.99%, H 4.79%, O 15.22% Standard InChI InChI=1S/C14H10O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H Standard InChIKey WURBFLDFSFBTLW-UHFFFAOYSA-N